C10H12ClF3N4O2 — CID 177168159
tert-butyl N-[[4-chloro-5-(trifluoromethyl)pyrimidin-2-yl]amino]carbamate (PubChem CID 177168159) has the molecular formula C10H12ClF3N4O2 and a molecular weight of 312.68 g/mol. Its IUPAC name is tert-butyl N-[[4-chloro-5-(trifluoromethyl)pyrimidin-2-yl]amino]carbamate.
| Compound Name | tert-butyl N-[[4-chloro-5-(trifluoromethyl)pyrimidin-2-yl]amino]carbamate |
|---|---|
| PubChem CID | 177168159 |
| Molecular Formula | C10H12ClF3N4O2 |
| Molecular Weight | 312.68 g/mol |
| Exact Mass | 312.06 |
| IUPAC Name | tert-butyl N-[[4-chloro-5-(trifluoromethyl)pyrimidin-2-yl]amino]carbamate |
| SMILES | CC(C)(C)OC(=O)NNc1ncc(C(F)(F)F)c(Cl)n1 |
| InChI | InChI=1S/C10H12ClF3N4O2/c1-9(2,3)20-8(19)18-17-7-15-4-5(6(11)16-7)10(12,13)14/h4H,1-3H3,(H,18,19)(H,15,16,17) |
| InChIKey | OBYWCDMJYFGWOL-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.68 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|