C9H12ClFN4O2 — CID 124896195
tert-butyl N-[(2-chloro-5-fluoropyrimidin-4-yl)amino]carbamate (PubChem CID 124896195) has the molecular formula C9H12ClFN4O2 and a molecular weight of 262.67 g/mol. Its IUPAC name is tert-butyl N-[(2-chloro-5-fluoropyrimidin-4-yl)amino]carbamate.
| Compound Name | tert-butyl N-[(2-chloro-5-fluoropyrimidin-4-yl)amino]carbamate |
|---|---|
| PubChem CID | 124896195 |
| Molecular Formula | C9H12ClFN4O2 |
| Molecular Weight | 262.67 g/mol |
| Exact Mass | 262.06 |
| IUPAC Name | tert-butyl N-[(2-chloro-5-fluoropyrimidin-4-yl)amino]carbamate |
| SMILES | CC(C)(C)OC(=O)NNc1nc(Cl)ncc1F |
| InChI | InChI=1S/C9H12ClFN4O2/c1-9(2,3)17-8(16)15-14-6-5(11)4-12-7(10)13-6/h4H,1-3H3,(H,15,16)(H,12,13,14) |
| InChIKey | FAEDIYVVZLYGAW-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.67 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|