C9H13BrN4O2 — CID 74788504
tert-butyl N-[(5-bromopyrimidin-2-yl)amino]carbamate (PubChem CID 74788504) has the molecular formula C9H13BrN4O2 and a molecular weight of 289.13 g/mol. Its IUPAC name is tert-butyl N-[(5-bromopyrimidin-2-yl)amino]carbamate.
| Compound Name | tert-butyl N-[(5-bromopyrimidin-2-yl)amino]carbamate |
|---|---|
| PubChem CID | 74788504 |
| Molecular Formula | C9H13BrN4O2 |
| Molecular Weight | 289.13 g/mol |
| Exact Mass | 288.02 |
| IUPAC Name | tert-butyl N-[(5-bromopyrimidin-2-yl)amino]carbamate |
| SMILES | CC(C)(C)OC(=O)NNc1ncc(Br)cn1 |
| InChI | InChI=1S/C9H13BrN4O2/c1-9(2,3)16-8(15)14-13-7-11-4-6(10)5-12-7/h4-5H,1-3H3,(H,14,15)(H,11,12,13) |
| InChIKey | QWJRMGBFMCHITC-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.13 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|