C9H14O8 — CID 46915975
(1S,4R,5R,6R,7S)-4-[(1R)-1,2-dihydroxyethyl]-1,6,7-trihydroxy-3,9-dioxabicyclo[3.3.1]nonan-2-one (PubChem CID 46915975) has the molecular formula C9H14O8 and a molecular weight of 250.20 g/mol. Its IUPAC name is (1S,4R,5R,6R,7S)-4-[(1R)-1,2-dihydroxyethyl]-1,6,7-trihydroxy-3,9-dioxabicyclo[3.3.1]nonan-2-one.
| Compound Name | (1S,4R,5R,6R,7S)-4-[(1R)-1,2-dihydroxyethyl]-1,6,7-trihydroxy-3,9-dioxabicyclo[3.3.1]nonan-2-one |
|---|---|
| PubChem CID | 46915975 |
| Molecular Formula | C9H14O8 |
| Molecular Weight | 250.20 g/mol |
| Exact Mass | 250.07 |
| IUPAC Name | (1S,4R,5R,6R,7S)-4-[(1R)-1,2-dihydroxyethyl]-1,6,7-trihydroxy-3,9-dioxabicyclo[3.3.1]nonan-2-one |
| SMILES | O=C1O[C@H]([C@H](O)CO)[C@@H]2O[C@@]1(O)C[C@H](O)[C@H]2O |
| InChI | InChI=1S/C9H14O8/c10-2-4(12)6-7-5(13)3(11)1-9(15,17-7)8(14)16-6/h3-7,10-13,15H,1-2H2/t3-,4+,5+,6+,7+,9-/m0/s1 |
| InChIKey | DEXXDCBHLQWNMP-YOQZMRDMSA-N |
| XLogP | -3.54 |
| TPSA | 136.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.20 |
| LogP ≤ 5 | -3.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |