C8H12N4O — CID 46917166
3-(1,2-dideuterioethyl)-5-(1,4,5,6-tetrahydropyrimidin-5-yl)-1,2,4-oxadiazole (PubChem CID 46917166) has the molecular formula C8H12N4O and a molecular weight of 182.22 g/mol. Its IUPAC name is 3-(1,2-dideuterioethyl)-5-(1,4,5,6-tetrahydropyrimidin-5-yl)-1,2,4-oxadiazole.
| Compound Name | 3-(1,2-dideuterioethyl)-5-(1,4,5,6-tetrahydropyrimidin-5-yl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 46917166 |
| Molecular Formula | C8H12N4O |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | 3-(1,2-dideuterioethyl)-5-(1,4,5,6-tetrahydropyrimidin-5-yl)-1,2,4-oxadiazole |
| SMILES | [2H]CC([2H])c1noc(C2CN=CNC2)n1 |
| InChI | InChI=1S/C8H12N4O/c1-2-7-11-8(13-12-7)6-3-9-5-10-4-6/h5-6H,2-4H2,1H3,(H,9,10)/i1D,2D |
| InChIKey | IPKFWLRXFSUTDZ-QDNHWIQGSA-N |
| XLogP | 0.35 |
| TPSA | 63.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |