C22H28F2N8O3 — CID 46917848
3-[2-(difluoromethyl)-1-(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)benzimidazol-4-yl]oxypropan-1-amine (PubChem CID 46917848) has the molecular formula C22H28F2N8O3 and a molecular weight of 490.52 g/mol. Its IUPAC name is 3-[2-(difluoromethyl)-1-(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)benzimidazol-4-yl]oxypropan-1-amine.
| Compound Name | 3-[2-(difluoromethyl)-1-(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)benzimidazol-4-yl]oxypropan-1-amine |
|---|---|
| PubChem CID | 46917848 |
| Molecular Formula | C22H28F2N8O3 |
| Molecular Weight | 490.52 g/mol |
| Exact Mass | 490.23 |
| IUPAC Name | 3-[2-(difluoromethyl)-1-(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)benzimidazol-4-yl]oxypropan-1-amine |
| SMILES | NCCCOc1cccc2c1nc(C(F)F)n2-c1nc(N2CCOCC2)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C22H28F2N8O3/c23-18(24)19-26-17-15(3-1-4-16(17)35-10-2-5-25)32(19)22-28-20(30-6-11-33-12-7-30)27-21(29-22)31-8-13-34-14-9-31/h1,3-4,18H,2,5-14,25H2 |
| InChIKey | GGMKDASHUMEVNZ-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 116.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.52 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|