C23H30N2O4S — CID 46918492
(4S)-4-[(E,1S)-1-[benzyl(benzylsulfamoyl)amino]but-2-enyl]-2,2-dimethyl-1,3-dioxolane (PubChem CID 46918492) has the molecular formula C23H30N2O4S and a molecular weight of 430.57 g/mol. Its IUPAC name is (4S)-4-[(E,1S)-1-[benzyl(benzylsulfamoyl)amino]but-2-enyl]-2,2-dimethyl-1,3-dioxolane.
| Compound Name | (4S)-4-[(E,1S)-1-[benzyl(benzylsulfamoyl)amino]but-2-enyl]-2,2-dimethyl-1,3-dioxolane |
|---|---|
| PubChem CID | 46918492 |
| Molecular Formula | C23H30N2O4S |
| Molecular Weight | 430.57 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | (4S)-4-[(E,1S)-1-[benzyl(benzylsulfamoyl)amino]but-2-enyl]-2,2-dimethyl-1,3-dioxolane |
| SMILES | C/C=C/[C@@H]([C@H]1COC(C)(C)O1)N(Cc1ccccc1)S(=O)(=O)NCc1ccccc1 |
| InChI | InChI=1S/C23H30N2O4S/c1-4-11-21(22-18-28-23(2,3)29-22)25(17-20-14-9-6-10-15-20)30(26,27)24-16-19-12-7-5-8-13-19/h4-15,21-22,24H,16-18H2,1-3H3/b11-4+/t21-,22+/m0/s1 |
| InChIKey | JCHDAHURNLVIMB-GUVLNOLPSA-N |
| XLogP | 3.62 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.57 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|