C19H28O4 — CID 46919313
(1S,4S,5R,7S,9S,10R,13R)-7-hydroxy-5,9-dimethyl-14-oxotetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylic acid (PubChem CID 46919313) has the molecular formula C19H28O4 and a molecular weight of 320.43 g/mol. Its IUPAC name is (1S,4S,5R,7S,9S,10R,13R)-7-hydroxy-5,9-dimethyl-14-oxotetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylic acid.
| Compound Name | (1S,4S,5R,7S,9S,10R,13R)-7-hydroxy-5,9-dimethyl-14-oxotetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylic acid |
|---|---|
| PubChem CID | 46919313 |
| Molecular Formula | C19H28O4 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | (1S,4S,5R,7S,9S,10R,13R)-7-hydroxy-5,9-dimethyl-14-oxotetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylic acid |
| SMILES | C[C@@]12C[C@H](O)C[C@@](C)(C(=O)O)[C@H]1CC[C@]13CC(=O)[C@H](CC[C@H]12)C3 |
| InChI | InChI=1S/C19H28O4/c1-17-8-12(20)9-18(2,16(22)23)14(17)5-6-19-7-11(13(21)10-19)3-4-15(17)19/h11-12,14-15,20H,3-10H2,1-2H3,(H,22,23)/t11-,12+,14+,15+,17-,18-,19+/m1/s1 |
| InChIKey | HMXJRQVUWGOPOX-WYFVZXNTSA-N |
| XLogP | 3.02 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |