C23H38N4O5 — CID 46919648
tert-butyl N-[(2S)-1-[[(3E,5S,8S,9E)-2,7-dioxo-5-propan-2-yl-1,6-diazacyclododeca-3,9-dien-8-yl]amino]-3-methyl-1-oxobutan-2-yl]carbamate (PubChem CID 46919648) has the molecular formula C23H38N4O5 and a molecular weight of 450.58 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-[[(3E,5S,8S,9E)-2,7-dioxo-5-propan-2-yl-1,6-diazacyclododeca-3,9-dien-8-yl]amino]-3-methyl-1-oxobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-[[(3E,5S,8S,9E)-2,7-dioxo-5-propan-2-yl-1,6-diazacyclododeca-3,9-dien-8-yl]amino]-3-methyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 46919648 |
| Molecular Formula | C23H38N4O5 |
| Molecular Weight | 450.58 g/mol |
| Exact Mass | 450.28 |
| IUPAC Name | tert-butyl N-[(2S)-1-[[(3E,5S,8S,9E)-2,7-dioxo-5-propan-2-yl-1,6-diazacyclododeca-3,9-dien-8-yl]amino]-3-methyl-1-oxobutan-2-yl]carbamate |
| SMILES | CC(C)[C@H](NC(=O)OC(C)(C)C)C(=O)N[C@H]1/C=C/CCNC(=O)/C=C/[C@H](C(C)C)NC1=O |
| InChI | InChI=1S/C23H38N4O5/c1-14(2)16-11-12-18(28)24-13-9-8-10-17(20(29)25-16)26-21(30)19(15(3)4)27-22(31)32-23(5,6)7/h8,10-12,14-17,19H,9,13H2,1-7H3,(H,24,28)(H,25,29)(H,26,30)(H,27,31)/b10-8+,12-11+/t16-,17+,19+/m1/s1 |
| InChIKey | GJDVJHJAGOUBCB-BGPGNRTJSA-N |
| XLogP | 1.79 |
| TPSA | 125.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.58 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|