C14H24N2O4 — CID 91692137
tert-butyl N-[(2S)-1-oxo-1-[[(E,2S)-5-oxohex-3-en-2-yl]amino]propan-2-yl]carbamate (PubChem CID 91692137) has the molecular formula C14H24N2O4 and a molecular weight of 284.36 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-oxo-1-[[(E,2S)-5-oxohex-3-en-2-yl]amino]propan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-oxo-1-[[(E,2S)-5-oxohex-3-en-2-yl]amino]propan-2-yl]carbamate |
|---|---|
| PubChem CID | 91692137 |
| Molecular Formula | C14H24N2O4 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.17 |
| IUPAC Name | tert-butyl N-[(2S)-1-oxo-1-[[(E,2S)-5-oxohex-3-en-2-yl]amino]propan-2-yl]carbamate |
| SMILES | CC(=O)/C=C/[C@H](C)NC(=O)[C@H](C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H24N2O4/c1-9(7-8-10(2)17)15-12(18)11(3)16-13(19)20-14(4,5)6/h7-9,11H,1-6H3,(H,15,18)(H,16,19)/b8-7+/t9-,11-/m0/s1 |
| InChIKey | BMJWIWIWVGOPSJ-QARYBLBWSA-N |
| XLogP | 1.55 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|