C11H17N3O4 — CID 18607032
tert-butyl N-[(2S,3R)-2-[(E)-3-amino-3-oxoprop-1-enyl]-4-oxoazetidin-3-yl]carbamate (PubChem CID 18607032) has the molecular formula C11H17N3O4 and a molecular weight of 255.27 g/mol. Its IUPAC name is tert-butyl N-[(2S,3R)-2-[(E)-3-amino-3-oxoprop-1-enyl]-4-oxoazetidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(2S,3R)-2-[(E)-3-amino-3-oxoprop-1-enyl]-4-oxoazetidin-3-yl]carbamate |
|---|---|
| PubChem CID | 18607032 |
| Molecular Formula | C11H17N3O4 |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.12 |
| IUPAC Name | tert-butyl N-[(2S,3R)-2-[(E)-3-amino-3-oxoprop-1-enyl]-4-oxoazetidin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1C(=O)N[C@H]1/C=C/C(N)=O |
| InChI | InChI=1S/C11H17N3O4/c1-11(2,3)18-10(17)14-8-6(13-9(8)16)4-5-7(12)15/h4-6,8H,1-3H3,(H2,12,15)(H,13,16)(H,14,17)/b5-4+/t6-,8+/m0/s1 |
| InChIKey | SBOVKKFBEPSWRA-KIEHPGSMSA-N |
| XLogP | -0.58 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|