C13H15BO4 — CID 46919868
methyl (3R)-3-[(3S)-1-hydroxy-3H-2,1-benzoxaborol-3-yl]-2-methylidenebutanoate (PubChem CID 46919868) has the molecular formula C13H15BO4 and a molecular weight of 246.07 g/mol. Its IUPAC name is methyl (3R)-3-[(3S)-1-hydroxy-3H-2,1-benzoxaborol-3-yl]-2-methylidenebutanoate.
| Compound Name | methyl (3R)-3-[(3S)-1-hydroxy-3H-2,1-benzoxaborol-3-yl]-2-methylidenebutanoate |
|---|---|
| PubChem CID | 46919868 |
| Molecular Formula | C13H15BO4 |
| Molecular Weight | 246.07 g/mol |
| Exact Mass | 246.11 |
| IUPAC Name | methyl (3R)-3-[(3S)-1-hydroxy-3H-2,1-benzoxaborol-3-yl]-2-methylidenebutanoate |
| SMILES | C=C(C(=O)OC)[C@@H](C)[C@@H]1OB(O)c2ccccc21 |
| InChI | InChI=1S/C13H15BO4/c1-8(9(2)13(15)17-3)12-10-6-4-5-7-11(10)14(16)18-12/h4-8,12,16H,2H2,1,3H3/t8-,12+/m1/s1 |
| InChIKey | KWRPDDSQKZIJQU-PELKAZGASA-N |
| XLogP | 0.81 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.07 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|