C17H11ClF3N3O2 — CID 46920090
3-(2-chlorophenyl)-N-[3-(trifluoromethoxy)phenyl]-1H-pyrazole-5-carboxamide (PubChem CID 46920090) has the molecular formula C17H11ClF3N3O2 and a molecular weight of 381.74 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-N-[3-(trifluoromethoxy)phenyl]-1H-pyrazole-5-carboxamide.
| Compound Name | 3-(2-chlorophenyl)-N-[3-(trifluoromethoxy)phenyl]-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 46920090 |
| Molecular Formula | C17H11ClF3N3O2 |
| Molecular Weight | 381.74 g/mol |
| Exact Mass | 381.05 |
| IUPAC Name | 3-(2-chlorophenyl)-N-[3-(trifluoromethoxy)phenyl]-1H-pyrazole-5-carboxamide |
| SMILES | O=C(Nc1cccc(OC(F)(F)F)c1)c1cc(-c2ccccc2Cl)n[nH]1 |
| InChI | InChI=1S/C17H11ClF3N3O2/c18-13-7-2-1-6-12(13)14-9-15(24-23-14)16(25)22-10-4-3-5-11(8-10)26-17(19,20)21/h1-9H,(H,22,25)(H,23,24) |
| InChIKey | IULPBPVLYCEYJQ-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.74 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |