C24H19ClN6O5S — CID 46924586
2-[(E)-[[2-[[5-(4-chlorophenyl)-4-phenyl-1H-1,2,4-triazol-4-ium-3-yl]sulfanyl]acetyl]hydrazinylidene]methyl]-6-methoxy-4-nitrophenolate (PubChem CID 46924586) has the molecular formula C24H19ClN6O5S and a molecular weight of 538.97 g/mol. Its IUPAC name is 2-[(E)-[[2-[[5-(4-chlorophenyl)-4-phenyl-1H-1,2,4-triazol-4-ium-3-yl]sulfanyl]acetyl]hydrazinylidene]methyl]-6-methoxy-4-nitrophenolate.
| Compound Name | 2-[(E)-[[2-[[5-(4-chlorophenyl)-4-phenyl-1H-1,2,4-triazol-4-ium-3-yl]sulfanyl]acetyl]hydrazinylidene]methyl]-6-methoxy-4-nitrophenolate |
|---|---|
| PubChem CID | 46924586 |
| Molecular Formula | C24H19ClN6O5S |
| Molecular Weight | 538.97 g/mol |
| Exact Mass | 538.08 |
| IUPAC Name | 2-[(E)-[[2-[[5-(4-chlorophenyl)-4-phenyl-1H-1,2,4-triazol-4-ium-3-yl]sulfanyl]acetyl]hydrazinylidene]methyl]-6-methoxy-4-nitrophenolate |
| SMILES | COc1cc([N+](=O)[O-])cc(/C=N/NC(=O)CSc2n[nH]c(-c3ccc(Cl)cc3)[n+]2-c2ccccc2)c1[O-] |
| InChI | InChI=1S/C24H19ClN6O5S/c1-36-20-12-19(31(34)35)11-16(22(20)33)13-26-27-21(32)14-37-24-29-28-23(15-7-9-17(25)10-8-15)30(24)18-5-3-2-4-6-18/h2-13H,14H2,1H3,(H2,26,27,32,33) |
| InChIKey | WZZZUSVHEVXULF-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 149.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.97 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|