C6H7O7- — CID 46926210
(2S,3S,4S,5R)-3,4,5-trihydroxy-6-oxooxane-2-carboxylate (PubChem CID 46926210) has the molecular formula C6H7O7- and a molecular weight of 191.11 g/mol. Its IUPAC name is (2S,3S,4S,5R)-3,4,5-trihydroxy-6-oxooxane-2-carboxylate.
| Compound Name | (2S,3S,4S,5R)-3,4,5-trihydroxy-6-oxooxane-2-carboxylate |
|---|---|
| PubChem CID | 46926210 |
| Molecular Formula | C6H7O7- |
| Molecular Weight | 191.11 g/mol |
| Exact Mass | 191.02 |
| IUPAC Name | (2S,3S,4S,5R)-3,4,5-trihydroxy-6-oxooxane-2-carboxylate |
| SMILES | O=C([O-])[C@H]1OC(=O)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C6H8O7/c7-1-2(8)4(5(10)11)13-6(12)3(1)9/h1-4,7-9H,(H,10,11)/p-1/t1-,2-,3+,4-/m0/s1 |
| InChIKey | YLKFQNUGXOLRNI-QDQPNEQZSA-M |
| XLogP | -4.26 |
| TPSA | 127.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.11 |
| LogP ≤ 5 | -4.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |