C18H21ClN6O2 — CID 46928006
N'-[7-[1-(4-chloro-2-methylphenoxy)ethyl]-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]-N-propan-2-yloxymethanimidamide (PubChem CID 46928006) has the molecular formula C18H21ClN6O2 and a molecular weight of 388.86 g/mol. Its IUPAC name is N'-[7-[1-(4-chloro-2-methylphenoxy)ethyl]-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]-N-propan-2-yloxymethanimidamide.
| Compound Name | N'-[7-[1-(4-chloro-2-methylphenoxy)ethyl]-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]-N-propan-2-yloxymethanimidamide |
|---|---|
| PubChem CID | 46928006 |
| Molecular Formula | C18H21ClN6O2 |
| Molecular Weight | 388.86 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | N'-[7-[1-(4-chloro-2-methylphenoxy)ethyl]-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]-N-propan-2-yloxymethanimidamide |
| SMILES | Cc1cc(Cl)ccc1OC(C)c1ccnc2nc(/N=C/NOC(C)C)nn12 |
| InChI | InChI=1S/C18H21ClN6O2/c1-11(2)27-22-10-21-17-23-18-20-8-7-15(25(18)24-17)13(4)26-16-6-5-14(19)9-12(16)3/h5-11,13H,1-4H3,(H,21,22,24) |
| InChIKey | LOYMDPJUHFNKCW-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 85.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.86 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|