C33H37N3O4S — CID 4692901
[4-(4-tert-butylphenyl)sulfonylpiperazin-1-yl]-[5-(3-methoxyphenyl)-2-methyl-1-phenylpyrrol-3-yl]methanone (PubChem CID 4692901) has the molecular formula C33H37N3O4S and a molecular weight of 571.74 g/mol. Its IUPAC name is [4-(4-tert-butylphenyl)sulfonylpiperazin-1-yl]-[5-(3-methoxyphenyl)-2-methyl-1-phenylpyrrol-3-yl]methanone.
| Compound Name | [4-(4-tert-butylphenyl)sulfonylpiperazin-1-yl]-[5-(3-methoxyphenyl)-2-methyl-1-phenylpyrrol-3-yl]methanone |
|---|---|
| PubChem CID | 4692901 |
| Molecular Formula | C33H37N3O4S |
| Molecular Weight | 571.74 g/mol |
| Exact Mass | 571.25 |
| IUPAC Name | [4-(4-tert-butylphenyl)sulfonylpiperazin-1-yl]-[5-(3-methoxyphenyl)-2-methyl-1-phenylpyrrol-3-yl]methanone |
| SMILES | COc1cccc(-c2cc(C(=O)N3CCN(S(=O)(=O)c4ccc(C(C)(C)C)cc4)CC3)c(C)n2-c2ccccc2)c1 |
| InChI | InChI=1S/C33H37N3O4S/c1-24-30(23-31(25-10-9-13-28(22-25)40-5)36(24)27-11-7-6-8-12-27)32(37)34-18-20-35(21-19-34)41(38,39)29-16-14-26(15-17-29)33(2,3)4/h6-17,22-23H,18-21H2,1-5H3 |
| InChIKey | FXUWNZFTFKEAAR-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 71.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.74 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|