C41H63NO3 — CID 4692914
[10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] [1-(4-pentylphenyl)ethylideneamino] carbonate (PubChem CID 4692914) has the molecular formula C41H63NO3 and a molecular weight of 617.96 g/mol. Its IUPAC name is [10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] [1-(4-pentylphenyl)ethylideneamino] carbonate.
| Compound Name | [10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] [1-(4-pentylphenyl)ethylideneamino] carbonate |
|---|---|
| PubChem CID | 4692914 |
| Molecular Formula | C41H63NO3 |
| Molecular Weight | 617.96 g/mol |
| Exact Mass | 617.48 |
| IUPAC Name | [10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] [1-(4-pentylphenyl)ethylideneamino] carbonate |
| SMILES | CCCCCc1ccc(C(C)=NOC(=O)OC2CCC3(C)C(=CCC4C3CCC3(C)C(C(C)CCCC(C)C)CCC43)C2)cc1 |
| InChI | InChI=1S/C41H63NO3/c1-8-9-10-14-31-15-17-32(18-16-31)30(5)42-45-39(43)44-34-23-25-40(6)33(27-34)19-20-35-37-22-21-36(29(4)13-11-12-28(2)3)41(37,7)26-24-38(35)40/h15-19,28-29,34-38H,8-14,20-27H2,1-7H3 |
| InChIKey | HMIPRPOPZNOUAA-UHFFFAOYSA-N |
| XLogP | 11.71 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.96 |
| LogP ≤ 5 | 11.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|