C26H25NO3S — CID 46930110
[(3S,4R)-4-ethenyl-1-(4-methylphenyl)sulfonylpyrrolidin-3-yl]-(4-phenylphenyl)methanone (PubChem CID 46930110) has the molecular formula C26H25NO3S and a molecular weight of 431.56 g/mol. Its IUPAC name is [(3S,4R)-4-ethenyl-1-(4-methylphenyl)sulfonylpyrrolidin-3-yl]-(4-phenylphenyl)methanone.
| Compound Name | [(3S,4R)-4-ethenyl-1-(4-methylphenyl)sulfonylpyrrolidin-3-yl]-(4-phenylphenyl)methanone |
|---|---|
| PubChem CID | 46930110 |
| Molecular Formula | C26H25NO3S |
| Molecular Weight | 431.56 g/mol |
| Exact Mass | 431.16 |
| IUPAC Name | [(3S,4R)-4-ethenyl-1-(4-methylphenyl)sulfonylpyrrolidin-3-yl]-(4-phenylphenyl)methanone |
| SMILES | C=C[C@H]1CN(S(=O)(=O)c2ccc(C)cc2)C[C@H]1C(=O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C26H25NO3S/c1-3-20-17-27(31(29,30)24-15-9-19(2)10-16-24)18-25(20)26(28)23-13-11-22(12-14-23)21-7-5-4-6-8-21/h3-16,20,25H,1,17-18H2,2H3/t20-,25+/m0/s1 |
| InChIKey | GPFRBCAXVGDKGB-NBGIEHNGSA-N |
| XLogP | 4.97 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.56 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|