C29H36N6O4 — CID 46930912
tert-butyl N-[(3S,6S,9R,10aR)-9-azido-3-(benzhydrylcarbamoyl)-5-oxo-2,3,6,7,8,9,10,10a-octahydro-1H-pyrrolo[1,2-a]azocin-6-yl]carbamate (PubChem CID 46930912) has the molecular formula C29H36N6O4 and a molecular weight of 532.65 g/mol. Its IUPAC name is tert-butyl N-[(3S,6S,9R,10aR)-9-azido-3-(benzhydrylcarbamoyl)-5-oxo-2,3,6,7,8,9,10,10a-octahydro-1H-pyrrolo[1,2-a]azocin-6-yl]carbamate.
| Compound Name | tert-butyl N-[(3S,6S,9R,10aR)-9-azido-3-(benzhydrylcarbamoyl)-5-oxo-2,3,6,7,8,9,10,10a-octahydro-1H-pyrrolo[1,2-a]azocin-6-yl]carbamate |
|---|---|
| PubChem CID | 46930912 |
| Molecular Formula | C29H36N6O4 |
| Molecular Weight | 532.65 g/mol |
| Exact Mass | 532.28 |
| IUPAC Name | tert-butyl N-[(3S,6S,9R,10aR)-9-azido-3-(benzhydrylcarbamoyl)-5-oxo-2,3,6,7,8,9,10,10a-octahydro-1H-pyrrolo[1,2-a]azocin-6-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CC[C@@H](N=[N+]=[N-])C[C@H]2CC[C@@H](C(=O)NC(c3ccccc3)c3ccccc3)N2C1=O |
| InChI | InChI=1S/C29H36N6O4/c1-29(2,3)39-28(38)31-23-16-14-21(33-34-30)18-22-15-17-24(35(22)27(23)37)26(36)32-25(19-10-6-4-7-11-19)20-12-8-5-9-13-20/h4-13,21-25H,14-18H2,1-3H3,(H,31,38)(H,32,36)/t21-,22-,23+,24+/m1/s1 |
| InChIKey | CQYLXGZTGGRLMY-LWSSLDFYSA-N |
| XLogP | 5.01 |
| TPSA | 136.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.65 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|