C24H27BN4O3 — CID 59207967
CID 59207967 (PubChem CID 59207967) has the molecular formula C24H27BN4O3 and a molecular weight of 430.32 g/mol.
| Compound Name | CID 59207967 |
|---|---|
| PubChem CID | 59207967 |
| Molecular Formula | C24H27BN4O3 |
| Molecular Weight | 430.32 g/mol |
| Exact Mass | 430.22 |
| IUPAC Name | — |
| SMILES | [B][C@H](N)C(=O)N[C@H]1CCC2CC[C@@H](C(=O)NC(c3ccccc3)c3ccccc3)N2C1=O |
| InChI | InChI=1S/C24H27BN4O3/c25-21(26)23(31)27-18-13-11-17-12-14-19(29(17)24(18)32)22(30)28-20(15-7-3-1-4-8-15)16-9-5-2-6-10-16/h1-10,17-21H,11-14,26H2,(H,27,31)(H,28,30)/t17?,18-,19-,21+/m0/s1 |
| InChIKey | LYZZWVWBYCCPML-UKMZSXBKSA-N |
| XLogP | 0.98 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.32 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|