C38H24Cl2F5N3O5 — CID 4693151
2-(4-anilinophenyl)-6a,9a-dichloro-6-(4-hydroxyphenyl)-8-(2,3,4,5,6-pentafluorophenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 4693151) has the molecular formula C38H24Cl2F5N3O5 and a molecular weight of 768.52 g/mol. Its IUPAC name is 2-(4-anilinophenyl)-6a,9a-dichloro-6-(4-hydroxyphenyl)-8-(2,3,4,5,6-pentafluorophenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 2-(4-anilinophenyl)-6a,9a-dichloro-6-(4-hydroxyphenyl)-8-(2,3,4,5,6-pentafluorophenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 4693151 |
| Molecular Formula | C38H24Cl2F5N3O5 |
| Molecular Weight | 768.52 g/mol |
| Exact Mass | 767.10 |
| IUPAC Name | 2-(4-anilinophenyl)-6a,9a-dichloro-6-(4-hydroxyphenyl)-8-(2,3,4,5,6-pentafluorophenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | O=C1C2CC=C3C(CC4(Cl)C(=O)N(c5c(F)c(F)c(F)c(F)c5F)C(=O)C4(Cl)C3c3ccc(O)cc3)C2C(=O)N1c1ccc(Nc2ccccc2)cc1 |
| InChI | InChI=1S/C38H24Cl2F5N3O5/c39-37-16-24-22(14-15-23-25(24)34(51)47(33(23)50)20-10-8-19(9-11-20)46-18-4-2-1-3-5-18)26(17-6-12-21(49)13-7-17)38(37,40)36(53)48(35(37)52)32-30(44)28(42)27(41)29(43)31(32)45/h1-14,23-26,46,49H,15-16H2 |
| InChIKey | GDBBBKNCPIDZGR-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 768.52 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|