C35H35NO3 — CID 46932773
(3R,4R)-3-(2,2-dimethylpropanoyl)-4-(phenylmethoxymethyl)-1-tritylazetidin-2-one (PubChem CID 46932773) has the molecular formula C35H35NO3 and a molecular weight of 517.67 g/mol. Its IUPAC name is (3R,4R)-3-(2,2-dimethylpropanoyl)-4-(phenylmethoxymethyl)-1-tritylazetidin-2-one.
| Compound Name | (3R,4R)-3-(2,2-dimethylpropanoyl)-4-(phenylmethoxymethyl)-1-tritylazetidin-2-one |
|---|---|
| PubChem CID | 46932773 |
| Molecular Formula | C35H35NO3 |
| Molecular Weight | 517.67 g/mol |
| Exact Mass | 517.26 |
| IUPAC Name | (3R,4R)-3-(2,2-dimethylpropanoyl)-4-(phenylmethoxymethyl)-1-tritylazetidin-2-one |
| SMILES | CC(C)(C)C(=O)[C@@H]1C(=O)N(C(c2ccccc2)(c2ccccc2)c2ccccc2)[C@H]1COCc1ccccc1 |
| InChI | InChI=1S/C35H35NO3/c1-34(2,3)32(37)31-30(25-39-24-26-16-8-4-9-17-26)36(33(31)38)35(27-18-10-5-11-19-27,28-20-12-6-13-21-28)29-22-14-7-15-23-29/h4-23,30-31H,24-25H2,1-3H3/t30-,31+/m0/s1 |
| InChIKey | UBBUGJUTLGZKNQ-IOWSJCHKSA-N |
| XLogP | 6.64 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.67 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|