C24H20N4O4 — CID 46934000
(5R)-5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-5-(4-pyridin-3-ylphenyl)imidazolidine-2,4-dione (PubChem CID 46934000) has the molecular formula C24H20N4O4 and a molecular weight of 428.45 g/mol. Its IUPAC name is (5R)-5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-5-(4-pyridin-3-ylphenyl)imidazolidine-2,4-dione.
| Compound Name | (5R)-5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-5-(4-pyridin-3-ylphenyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 46934000 |
| Molecular Formula | C24H20N4O4 |
| Molecular Weight | 428.45 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | (5R)-5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-5-(4-pyridin-3-ylphenyl)imidazolidine-2,4-dione |
| SMILES | COc1ccc2c(c1)C(=O)N(C[C@@]1(c3ccc(-c4cccnc4)cc3)NC(=O)NC1=O)C2 |
| InChI | InChI=1S/C24H20N4O4/c1-32-19-9-6-17-13-28(21(29)20(17)11-19)14-24(22(30)26-23(31)27-24)18-7-4-15(5-8-18)16-3-2-10-25-12-16/h2-12H,13-14H2,1H3,(H2,26,27,30,31)/t24-/m0/s1 |
| InChIKey | XMSHNXONZBWQTA-DEOSSOPVSA-N |
| XLogP | 2.45 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.45 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|