C17H15N5O4 — CID 46881608
(5S)-5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-5-pyrazin-2-ylimidazolidine-2,4-dione (PubChem CID 46881608) has the molecular formula C17H15N5O4 and a molecular weight of 353.34 g/mol. Its IUPAC name is (5S)-5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-5-pyrazin-2-ylimidazolidine-2,4-dione.
| Compound Name | (5S)-5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-5-pyrazin-2-ylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 46881608 |
| Molecular Formula | C17H15N5O4 |
| Molecular Weight | 353.34 g/mol |
| Exact Mass | 353.11 |
| IUPAC Name | (5S)-5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-5-pyrazin-2-ylimidazolidine-2,4-dione |
| SMILES | COc1ccc2c(c1)C(=O)N(C[C@@]1(c3cnccn3)NC(=O)NC1=O)C2 |
| InChI | InChI=1S/C17H15N5O4/c1-26-11-3-2-10-8-22(14(23)12(10)6-11)9-17(13-7-18-4-5-19-13)15(24)20-16(25)21-17/h2-7H,8-9H2,1H3,(H2,20,21,24,25)/t17-/m0/s1 |
| InChIKey | NNWAOWAMVGAOSU-KRWDZBQOSA-N |
| XLogP | 0.18 |
| TPSA | 113.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.34 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|