C23H40O7Si — CID 46934747
1-[(3aR,4R,6R,7aR)-4-[(4S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-6-yl]prop-2-en-1-one (PubChem CID 46934747) has the molecular formula C23H40O7Si and a molecular weight of 456.65 g/mol. Its IUPAC name is 1-[(3aR,4R,6R,7aR)-4-[(4S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-6-yl]prop-2-en-1-one.
| Compound Name | 1-[(3aR,4R,6R,7aR)-4-[(4S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-6-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 46934747 |
| Molecular Formula | C23H40O7Si |
| Molecular Weight | 456.65 g/mol |
| Exact Mass | 456.25 |
| IUPAC Name | 1-[(3aR,4R,6R,7aR)-4-[(4S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-6-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)[C@H]1C[C@H]2OC(C)(C)O[C@H]2[C@H]([C@H]2OC(C)(C)O[C@@H]2CO[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C23H40O7Si/c1-11-14(24)15-12-16-18(29-22(5,6)27-16)20(26-15)19-17(28-23(7,8)30-19)13-25-31(9,10)21(2,3)4/h11,15-20H,1,12-13H2,2-10H3/t15-,16-,17-,18-,19+,20-/m1/s1 |
| InChIKey | BXYVKAQUBJVVJI-UXXOSCIKSA-N |
| XLogP | 3.96 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.65 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|