C28H50O7Si — CID 11114097
(3aR,4R,6S,7aR)-6-but-3-enyl-4-[(S)-[tert-butyl(dimethyl)silyl]oxy-[(4R)-2,2-diethyl-1,3-dioxolan-4-yl]methyl]-2,2-diethyl-4,7a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-one (PubChem CID 11114097) has the molecular formula C28H50O7Si and a molecular weight of 526.79 g/mol. Its IUPAC name is (3aR,4R,6S,7aR)-6-but-3-enyl-4-[(S)-[tert-butyl(dimethyl)silyl]oxy-[(4R)-2,2-diethyl-1,3-dioxolan-4-yl]methyl]-2,2-diethyl-4,7a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-one.
| Compound Name | (3aR,4R,6S,7aR)-6-but-3-enyl-4-[(S)-[tert-butyl(dimethyl)silyl]oxy-[(4R)-2,2-diethyl-1,3-dioxolan-4-yl]methyl]-2,2-diethyl-4,7a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-one |
|---|---|
| PubChem CID | 11114097 |
| Molecular Formula | C28H50O7Si |
| Molecular Weight | 526.79 g/mol |
| Exact Mass | 526.33 |
| IUPAC Name | (3aR,4R,6S,7aR)-6-but-3-enyl-4-[(S)-[tert-butyl(dimethyl)silyl]oxy-[(4R)-2,2-diethyl-1,3-dioxolan-4-yl]methyl]-2,2-diethyl-4,7a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-one |
| SMILES | C=CCC[C@@H]1O[C@@H]([C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2COC(CC)(CC)O2)[C@H]2OC(CC)(CC)O[C@H]2C1=O |
| InChI | InChI=1S/C28H50O7Si/c1-11-16-17-19-21(29)23-25(34-28(14-4,15-5)33-23)24(31-19)22(35-36(9,10)26(6,7)8)20-18-30-27(12-2,13-3)32-20/h11,19-20,22-25H,1,12-18H2,2-10H3/t19-,20+,22-,23-,24-,25-/m0/s1 |
| InChIKey | PCOHKWOWPXSHHA-VOHARBHYSA-N |
| XLogP | 5.91 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.79 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|