C18H14ClN5O4S — CID 46935199
N-[2-(4-chlorophenyl)-4-oxo-1,3-thiazolidin-3-yl]-2-(5-nitroindazol-1-yl)acetamide (PubChem CID 46935199) has the molecular formula C18H14ClN5O4S and a molecular weight of 431.86 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)-4-oxo-1,3-thiazolidin-3-yl]-2-(5-nitroindazol-1-yl)acetamide.
| Compound Name | N-[2-(4-chlorophenyl)-4-oxo-1,3-thiazolidin-3-yl]-2-(5-nitroindazol-1-yl)acetamide |
|---|---|
| PubChem CID | 46935199 |
| Molecular Formula | C18H14ClN5O4S |
| Molecular Weight | 431.86 g/mol |
| Exact Mass | 431.05 |
| IUPAC Name | N-[2-(4-chlorophenyl)-4-oxo-1,3-thiazolidin-3-yl]-2-(5-nitroindazol-1-yl)acetamide |
| SMILES | O=C(Cn1ncc2cc([N+](=O)[O-])ccc21)NN1C(=O)CSC1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H14ClN5O4S/c19-13-3-1-11(2-4-13)18-23(17(26)10-29-18)21-16(25)9-22-15-6-5-14(24(27)28)7-12(15)8-20-22/h1-8,18H,9-10H2,(H,21,25) |
| InChIKey | SJWDBKWBFHCWPA-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 110.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.86 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|