C18H15NO3S — CID 46938389
4-(4-methylsulfonylphenyl)-4H-pyrrolo[2,1-c][1,4]benzoxazine (PubChem CID 46938389) has the molecular formula C18H15NO3S and a molecular weight of 325.39 g/mol. Its IUPAC name is 4-(4-methylsulfonylphenyl)-4H-pyrrolo[2,1-c][1,4]benzoxazine.
| Compound Name | 4-(4-methylsulfonylphenyl)-4H-pyrrolo[2,1-c][1,4]benzoxazine |
|---|---|
| PubChem CID | 46938389 |
| Molecular Formula | C18H15NO3S |
| Molecular Weight | 325.39 g/mol |
| Exact Mass | 325.08 |
| IUPAC Name | 4-(4-methylsulfonylphenyl)-4H-pyrrolo[2,1-c][1,4]benzoxazine |
| SMILES | CS(=O)(=O)c1ccc(C2Oc3ccccc3-n3cccc32)cc1 |
| InChI | InChI=1S/C18H15NO3S/c1-23(20,21)14-10-8-13(9-11-14)18-16-6-4-12-19(16)15-5-2-3-7-17(15)22-18/h2-12,18H,1H3 |
| InChIKey | SFTNUIFOMNGJMA-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.39 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |