C21H18O5S — CID 46940222
[4-(2,4-dihydroxyphenyl)sulfanyl-3-hydroxyphenyl] 3-phenylpropanoate (PubChem CID 46940222) has the molecular formula C21H18O5S and a molecular weight of 382.44 g/mol. Its IUPAC name is [4-(2,4-dihydroxyphenyl)sulfanyl-3-hydroxyphenyl] 3-phenylpropanoate.
| Compound Name | [4-(2,4-dihydroxyphenyl)sulfanyl-3-hydroxyphenyl] 3-phenylpropanoate |
|---|---|
| PubChem CID | 46940222 |
| Molecular Formula | C21H18O5S |
| Molecular Weight | 382.44 g/mol |
| Exact Mass | 382.09 |
| IUPAC Name | [4-(2,4-dihydroxyphenyl)sulfanyl-3-hydroxyphenyl] 3-phenylpropanoate |
| SMILES | O=C(CCc1ccccc1)Oc1ccc(Sc2ccc(O)cc2O)c(O)c1 |
| InChI | InChI=1S/C21H18O5S/c22-15-7-9-19(17(23)12-15)27-20-10-8-16(13-18(20)24)26-21(25)11-6-14-4-2-1-3-5-14/h1-5,7-10,12-13,22-24H,6,11H2 |
| InChIKey | WJXLKGVYYHEJOV-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.44 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|