C19H18ClN2O3+ — CID 4694024
ethyl 6-chloro-4-(3-hydroxyanilino)-8-methylquinolin-1-ium-3-carboxylate (PubChem CID 4694024) has the molecular formula C19H18ClN2O3+ and a molecular weight of 357.82 g/mol. Its IUPAC name is ethyl 6-chloro-4-(3-hydroxyanilino)-8-methylquinolin-1-ium-3-carboxylate.
| Compound Name | ethyl 6-chloro-4-(3-hydroxyanilino)-8-methylquinolin-1-ium-3-carboxylate |
|---|---|
| PubChem CID | 4694024 |
| Molecular Formula | C19H18ClN2O3+ |
| Molecular Weight | 357.82 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | ethyl 6-chloro-4-(3-hydroxyanilino)-8-methylquinolin-1-ium-3-carboxylate |
| SMILES | CCOC(=O)c1c[nH+]c2c(C)cc(Cl)cc2c1Nc1cccc(O)c1 |
| InChI | InChI=1S/C19H17ClN2O3/c1-3-25-19(24)16-10-21-17-11(2)7-12(20)8-15(17)18(16)22-13-5-4-6-14(23)9-13/h4-10,23H,3H2,1-2H3,(H,21,22)/p+1 |
| InChIKey | PWQUMTAOUZDLDL-UHFFFAOYSA-O |
| XLogP | 4.24 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.82 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |