C22H15Cl3F3NO4 — CID 46940558
3-chloro-4-[3-chloro-4-[3-(2-chloro-4-pyridinyl)-4,4,4-trifluoro-3-hydroxybutan-2-yl]phenoxy]benzoic acid (PubChem CID 46940558) has the molecular formula C22H15Cl3F3NO4 and a molecular weight of 520.72 g/mol. Its IUPAC name is 3-chloro-4-[3-chloro-4-[3-(2-chloro-4-pyridinyl)-4,4,4-trifluoro-3-hydroxybutan-2-yl]phenoxy]benzoic acid.
| Compound Name | 3-chloro-4-[3-chloro-4-[3-(2-chloro-4-pyridinyl)-4,4,4-trifluoro-3-hydroxybutan-2-yl]phenoxy]benzoic acid |
|---|---|
| PubChem CID | 46940558 |
| Molecular Formula | C22H15Cl3F3NO4 |
| Molecular Weight | 520.72 g/mol |
| Exact Mass | 519.00 |
| IUPAC Name | 3-chloro-4-[3-chloro-4-[3-(2-chloro-4-pyridinyl)-4,4,4-trifluoro-3-hydroxybutan-2-yl]phenoxy]benzoic acid |
| SMILES | CC(c1ccc(Oc2ccc(C(=O)O)cc2Cl)cc1Cl)C(O)(c1ccnc(Cl)c1)C(F)(F)F |
| InChI | InChI=1S/C22H15Cl3F3NO4/c1-11(21(32,22(26,27)28)13-6-7-29-19(25)9-13)15-4-3-14(10-16(15)23)33-18-5-2-12(20(30)31)8-17(18)24/h2-11,32H,1H3,(H,30,31) |
| InChIKey | GDQZFAIPIPOBBV-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 79.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.72 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|