C20H28N6O — CID 46943503
3-[butyl(methyl)amino]-N-(3-imidazol-1-ylpropyl)-2-methylimidazo[1,2-a]pyridine-6-carboxamide (PubChem CID 46943503) has the molecular formula C20H28N6O and a molecular weight of 368.49 g/mol. Its IUPAC name is 3-[butyl(methyl)amino]-N-(3-imidazol-1-ylpropyl)-2-methylimidazo[1,2-a]pyridine-6-carboxamide.
| Compound Name | 3-[butyl(methyl)amino]-N-(3-imidazol-1-ylpropyl)-2-methylimidazo[1,2-a]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 46943503 |
| Molecular Formula | C20H28N6O |
| Molecular Weight | 368.49 g/mol |
| Exact Mass | 368.23 |
| IUPAC Name | 3-[butyl(methyl)amino]-N-(3-imidazol-1-ylpropyl)-2-methylimidazo[1,2-a]pyridine-6-carboxamide |
| SMILES | CCCCN(C)c1c(C)nc2ccc(C(=O)NCCCn3ccnc3)cn12 |
| InChI | InChI=1S/C20H28N6O/c1-4-5-11-24(3)20-16(2)23-18-8-7-17(14-26(18)20)19(27)22-9-6-12-25-13-10-21-15-25/h7-8,10,13-15H,4-6,9,11-12H2,1-3H3,(H,22,27) |
| InChIKey | GEBZCMLJJQHCFI-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 67.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.49 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|