C27H24N4O2 — CID 46943779
N-(2-phenoxyethyl)-2-(3-phenylmethoxyphenyl)pyrazolo[1,5-a]pyrimidin-5-amine (PubChem CID 46943779) has the molecular formula C27H24N4O2 and a molecular weight of 436.52 g/mol. Its IUPAC name is N-(2-phenoxyethyl)-2-(3-phenylmethoxyphenyl)pyrazolo[1,5-a]pyrimidin-5-amine.
| Compound Name | N-(2-phenoxyethyl)-2-(3-phenylmethoxyphenyl)pyrazolo[1,5-a]pyrimidin-5-amine |
|---|---|
| PubChem CID | 46943779 |
| Molecular Formula | C27H24N4O2 |
| Molecular Weight | 436.52 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | N-(2-phenoxyethyl)-2-(3-phenylmethoxyphenyl)pyrazolo[1,5-a]pyrimidin-5-amine |
| SMILES | c1ccc(COc2cccc(-c3cc4nc(NCCOc5ccccc5)ccn4n3)c2)cc1 |
| InChI | InChI=1S/C27H24N4O2/c1-3-8-21(9-4-1)20-33-24-13-7-10-22(18-24)25-19-27-29-26(14-16-31(27)30-25)28-15-17-32-23-11-5-2-6-12-23/h1-14,16,18-19H,15,17,20H2,(H,28,29) |
| InChIKey | XXXJXMOFKYZPSR-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 60.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.52 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|