C20H21N5O2S — CID 46944231
N-[2-[[3-methyl-6-(1-methylindol-5-yl)-4-oxothieno[3,2-d]pyrimidin-2-yl]amino]ethyl]acetamide (PubChem CID 46944231) has the molecular formula C20H21N5O2S and a molecular weight of 395.49 g/mol. Its IUPAC name is N-[2-[[3-methyl-6-(1-methylindol-5-yl)-4-oxothieno[3,2-d]pyrimidin-2-yl]amino]ethyl]acetamide.
| Compound Name | N-[2-[[3-methyl-6-(1-methylindol-5-yl)-4-oxothieno[3,2-d]pyrimidin-2-yl]amino]ethyl]acetamide |
|---|---|
| PubChem CID | 46944231 |
| Molecular Formula | C20H21N5O2S |
| Molecular Weight | 395.49 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | N-[2-[[3-methyl-6-(1-methylindol-5-yl)-4-oxothieno[3,2-d]pyrimidin-2-yl]amino]ethyl]acetamide |
| SMILES | CC(=O)NCCNc1nc2cc(-c3ccc4c(ccn4C)c3)sc2c(=O)n1C |
| InChI | InChI=1S/C20H21N5O2S/c1-12(26)21-7-8-22-20-23-15-11-17(28-18(15)19(27)25(20)3)14-4-5-16-13(10-14)6-9-24(16)2/h4-6,9-11H,7-8H2,1-3H3,(H,21,26)(H,22,23) |
| InChIKey | NCPOATQUSBQSFN-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 80.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.49 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|