About 2,2-diheptoxypropyl ethyl sulfite
2,2-diheptoxypropyl ethyl sulfite (PubChem CID 46945493) has the molecular formula C19H40O5S
and a molecular weight of 380.59 g/mol. Its IUPAC name is 2,2-diheptoxypropyl ethyl sulfite.
Molecular Properties
| Compound Name | 2,2-diheptoxypropyl ethyl sulfite |
| PubChem CID | 46945493 |
| Molecular Formula | C19H40O5S |
| Molecular Weight | 380.59 g/mol |
| Exact Mass | 380.26 |
| IUPAC Name | 2,2-diheptoxypropyl ethyl sulfite |
| SMILES | CCCCCCCOC(C)(COS(=O)OCC)OCCCCCCC |
| InChI | InChI=1S/C19H40O5S/c1-5-8-10-12-14-16-21-19(4,18-24-25(20)23-7-3)22-17-15-13-11-9-6-2/h5-18H2,1-4H3 |
| InChIKey | YRPLHONZUIJRDJ-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 380.59 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2,2-diheptoxypropyl ethyl sulfite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-diheptoxypropyl ethyl sulfite?
The IUPAC name of 2,2-diheptoxypropyl ethyl sulfite (CID 46945493) is 2,2-diheptoxypropyl ethyl sulfite.
What is the SMILES notation for 2,2-diheptoxypropyl ethyl sulfite?
The canonical SMILES for 2,2-diheptoxypropyl ethyl sulfite is CCCCCCCOC(C)(COS(=O)OCC)OCCCCCCC.
What is the InChIKey of 2,2-diheptoxypropyl ethyl sulfite?
The InChIKey is YRPLHONZUIJRDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H40O5S/c1-5-8-10-12-14-16-21-19(4,18-24-25(20)23-7-3)22-17-15-13-11-9-6-2/h5-18H2,1-4H3.
What are the key properties of 2,2-diheptoxypropyl ethyl sulfite?
2,2-diheptoxypropyl ethyl sulfite has a molecular weight of 380.59 g/mol, XLogP of 5.31, 19 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-diheptoxypropyl ethyl sulfite is sourced from PubChem (CID 46945493), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).