C17H17NOS — CID 46947165
4-(4-methoxy-1-benzothiophen-2-yl)-N,N-dimethylaniline (PubChem CID 46947165) has the molecular formula C17H17NOS and a molecular weight of 283.40 g/mol. Its IUPAC name is 4-(4-methoxy-1-benzothiophen-2-yl)-N,N-dimethylaniline.
| Compound Name | 4-(4-methoxy-1-benzothiophen-2-yl)-N,N-dimethylaniline |
|---|---|
| PubChem CID | 46947165 |
| Molecular Formula | C17H17NOS |
| Molecular Weight | 283.40 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | 4-(4-methoxy-1-benzothiophen-2-yl)-N,N-dimethylaniline |
| SMILES | COc1cccc2sc(-c3ccc(N(C)C)cc3)cc12 |
| InChI | InChI=1S/C17H17NOS/c1-18(2)13-9-7-12(8-10-13)17-11-14-15(19-3)5-4-6-16(14)20-17/h4-11H,1-3H3 |
| InChIKey | CKYJMWJLBQKSOZ-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.40 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |