C22H22N2O5S — CID 46948899
3-methyl-4-phenyl-7-(3,4,5-trimethoxyphenyl)-6,7-dihydro-[1,3]thiazolo[4,5-b]pyridine-2,5-dione (PubChem CID 46948899) has the molecular formula C22H22N2O5S and a molecular weight of 426.49 g/mol. Its IUPAC name is 3-methyl-4-phenyl-7-(3,4,5-trimethoxyphenyl)-6,7-dihydro-[1,3]thiazolo[4,5-b]pyridine-2,5-dione.
| Compound Name | 3-methyl-4-phenyl-7-(3,4,5-trimethoxyphenyl)-6,7-dihydro-[1,3]thiazolo[4,5-b]pyridine-2,5-dione |
|---|---|
| PubChem CID | 46948899 |
| Molecular Formula | C22H22N2O5S |
| Molecular Weight | 426.49 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | 3-methyl-4-phenyl-7-(3,4,5-trimethoxyphenyl)-6,7-dihydro-[1,3]thiazolo[4,5-b]pyridine-2,5-dione |
| SMILES | COc1cc(C2CC(=O)N(c3ccccc3)c3c2sc(=O)n3C)cc(OC)c1OC |
| InChI | InChI=1S/C22H22N2O5S/c1-23-21-20(30-22(23)26)15(12-18(25)24(21)14-8-6-5-7-9-14)13-10-16(27-2)19(29-4)17(11-13)28-3/h5-11,15H,12H2,1-4H3 |
| InChIKey | GAGDOJAIZIQFAF-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 70.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.49 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |