C23H22N2O7S — CID 95167179
(7S)-7-(4,7-dimethoxy-1,3-benzodioxol-5-yl)-4-(3-methoxyphenyl)-3-methyl-6,7-dihydro-[1,3]thiazolo[4,5-b]pyridine-2,5-dione (PubChem CID 95167179) has the molecular formula C23H22N2O7S and a molecular weight of 470.50 g/mol. Its IUPAC name is (7S)-7-(4,7-dimethoxy-1,3-benzodioxol-5-yl)-4-(3-methoxyphenyl)-3-methyl-6,7-dihydro-[1,3]thiazolo[4,5-b]pyridine-2,5-dione.
| Compound Name | (7S)-7-(4,7-dimethoxy-1,3-benzodioxol-5-yl)-4-(3-methoxyphenyl)-3-methyl-6,7-dihydro-[1,3]thiazolo[4,5-b]pyridine-2,5-dione |
|---|---|
| PubChem CID | 95167179 |
| Molecular Formula | C23H22N2O7S |
| Molecular Weight | 470.50 g/mol |
| Exact Mass | 470.11 |
| IUPAC Name | (7S)-7-(4,7-dimethoxy-1,3-benzodioxol-5-yl)-4-(3-methoxyphenyl)-3-methyl-6,7-dihydro-[1,3]thiazolo[4,5-b]pyridine-2,5-dione |
| SMILES | COc1cccc(N2C(=O)C[C@@H](c3cc(OC)c4c(c3OC)OCO4)c3sc(=O)n(C)c32)c1 |
| InChI | InChI=1S/C23H22N2O7S/c1-24-22-21(33-23(24)27)15(10-17(26)25(22)12-6-5-7-13(8-12)28-2)14-9-16(29-3)19-20(18(14)30-4)32-11-31-19/h5-9,15H,10-11H2,1-4H3/t15-/m0/s1 |
| InChIKey | JXVMAKATPCKHFP-HNNXBMFYSA-N |
| XLogP | 3.40 |
| TPSA | 88.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.50 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |