C24H21ClN2O8S — CID 98084760
methyl 2-[(7S)-4-(3-chlorophenyl)-7-(4,7-dimethoxy-1,3-benzodioxol-5-yl)-2,5-dioxo-6,7-dihydro-[1,3]thiazolo[4,5-b]pyridin-3-yl]acetate (PubChem CID 98084760) has the molecular formula C24H21ClN2O8S and a molecular weight of 532.96 g/mol. Its IUPAC name is methyl 2-[(7S)-4-(3-chlorophenyl)-7-(4,7-dimethoxy-1,3-benzodioxol-5-yl)-2,5-dioxo-6,7-dihydro-[1,3]thiazolo[4,5-b]pyridin-3-yl]acetate.
| Compound Name | methyl 2-[(7S)-4-(3-chlorophenyl)-7-(4,7-dimethoxy-1,3-benzodioxol-5-yl)-2,5-dioxo-6,7-dihydro-[1,3]thiazolo[4,5-b]pyridin-3-yl]acetate |
|---|---|
| PubChem CID | 98084760 |
| Molecular Formula | C24H21ClN2O8S |
| Molecular Weight | 532.96 g/mol |
| Exact Mass | 532.07 |
| IUPAC Name | methyl 2-[(7S)-4-(3-chlorophenyl)-7-(4,7-dimethoxy-1,3-benzodioxol-5-yl)-2,5-dioxo-6,7-dihydro-[1,3]thiazolo[4,5-b]pyridin-3-yl]acetate |
| SMILES | COC(=O)Cn1c2c(sc1=O)[C@H](c1cc(OC)c3c(c1OC)OCO3)CC(=O)N2c1cccc(Cl)c1 |
| InChI | InChI=1S/C24H21ClN2O8S/c1-31-16-8-14(19(33-3)21-20(16)34-11-35-21)15-9-17(28)27(13-6-4-5-12(25)7-13)23-22(15)36-24(30)26(23)10-18(29)32-2/h4-8,15H,9-11H2,1-3H3/t15-/m0/s1 |
| InChIKey | PBLFYYNPVUCEQE-HNNXBMFYSA-N |
| XLogP | 3.68 |
| TPSA | 105.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.96 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |