C19H22N4O5 — CID 46950718
N-(3-ethoxypropyl)-2-[3-(furan-2-yl)-4-(3-methyl-1,2-oxazol-5-yl)-6-oxopyridazin-1-yl]acetamide (PubChem CID 46950718) has the molecular formula C19H22N4O5 and a molecular weight of 386.41 g/mol. Its IUPAC name is N-(3-ethoxypropyl)-2-[3-(furan-2-yl)-4-(3-methyl-1,2-oxazol-5-yl)-6-oxopyridazin-1-yl]acetamide.
| Compound Name | N-(3-ethoxypropyl)-2-[3-(furan-2-yl)-4-(3-methyl-1,2-oxazol-5-yl)-6-oxopyridazin-1-yl]acetamide |
|---|---|
| PubChem CID | 46950718 |
| Molecular Formula | C19H22N4O5 |
| Molecular Weight | 386.41 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | N-(3-ethoxypropyl)-2-[3-(furan-2-yl)-4-(3-methyl-1,2-oxazol-5-yl)-6-oxopyridazin-1-yl]acetamide |
| SMILES | CCOCCCNC(=O)Cn1nc(-c2ccco2)c(-c2cc(C)no2)cc1=O |
| InChI | InChI=1S/C19H22N4O5/c1-3-26-8-5-7-20-17(24)12-23-18(25)11-14(16-10-13(2)22-28-16)19(21-23)15-6-4-9-27-15/h4,6,9-11H,3,5,7-8,12H2,1-2H3,(H,20,24) |
| InChIKey | DAXGKNKPSLOQDE-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 112.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.41 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|