C24H25FN4O2 — CID 46951514
1-(4-fluorophenyl)-3-[4-[(2-methyl-6-piperidin-4-yl-4-pyridinyl)oxy]phenyl]urea (PubChem CID 46951514) has the molecular formula C24H25FN4O2 and a molecular weight of 420.49 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-3-[4-[(2-methyl-6-piperidin-4-yl-4-pyridinyl)oxy]phenyl]urea.
| Compound Name | 1-(4-fluorophenyl)-3-[4-[(2-methyl-6-piperidin-4-yl-4-pyridinyl)oxy]phenyl]urea |
|---|---|
| PubChem CID | 46951514 |
| Molecular Formula | C24H25FN4O2 |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | 1-(4-fluorophenyl)-3-[4-[(2-methyl-6-piperidin-4-yl-4-pyridinyl)oxy]phenyl]urea |
| SMILES | Cc1cc(Oc2ccc(NC(=O)Nc3ccc(F)cc3)cc2)cc(C2CCNCC2)n1 |
| InChI | InChI=1S/C24H25FN4O2/c1-16-14-22(15-23(27-16)17-10-12-26-13-11-17)31-21-8-6-20(7-9-21)29-24(30)28-19-4-2-18(25)3-5-19/h2-9,14-15,17,26H,10-13H2,1H3,(H2,28,29,30) |
| InChIKey | FTZWVFRXNYQBPK-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 75.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |