About N-[3-(2,2-dimethyloxan-4-yl)-3-(4-fluorophenyl)propyl]-2-methyloxolane-2-carboxamide
N-[3-(2,2-dimethyloxan-4-yl)-3-(4-fluorophenyl)propyl]-2-methyloxolane-2-carboxamide (PubChem CID 46954592) has the molecular formula C22H32FNO3
and a molecular weight of 377.50 g/mol. Its IUPAC name is N-[3-(2,2-dimethyloxan-4-yl)-3-(4-fluorophenyl)propyl]-2-methyloxolane-2-carboxamide.
Molecular Properties
| Compound Name | N-[3-(2,2-dimethyloxan-4-yl)-3-(4-fluorophenyl)propyl]-2-methyloxolane-2-carboxamide |
| PubChem CID | 46954592 |
| Molecular Formula | C22H32FNO3 |
| Molecular Weight | 377.50 g/mol |
| Exact Mass | 377.24 |
| IUPAC Name | N-[3-(2,2-dimethyloxan-4-yl)-3-(4-fluorophenyl)propyl]-2-methyloxolane-2-carboxamide |
| SMILES | CC1(C)CC(C(CCNC(=O)C2(C)CCCO2)c2ccc(F)cc2)CCO1 |
| InChI | InChI=1S/C22H32FNO3/c1-21(2)15-17(10-14-26-21)19(16-5-7-18(23)8-6-16)9-12-24-20(25)22(3)11-4-13-27-22/h5-8,17,19H,4,9-15H2,1-3H3,(H,24,25) |
| InChIKey | IDOIPAWMUBQQKH-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.50 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[3-(2,2-dimethyloxan-4-yl)-3-(4-fluorophenyl)propyl]-2-methyloxolane-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-(2,2-dimethyloxan-4-yl)-3-(4-fluorophenyl)propyl]-2-methyloxolane-2-carboxamide?
The IUPAC name of N-[3-(2,2-dimethyloxan-4-yl)-3-(4-fluorophenyl)propyl]-2-methyloxolane-2-carboxamide (CID 46954592) is N-[3-(2,2-dimethyloxan-4-yl)-3-(4-fluorophenyl)propyl]-2-methyloxolane-2-carboxamide.
What is the SMILES notation for N-[3-(2,2-dimethyloxan-4-yl)-3-(4-fluorophenyl)propyl]-2-methyloxolane-2-carboxamide?
The canonical SMILES for N-[3-(2,2-dimethyloxan-4-yl)-3-(4-fluorophenyl)propyl]-2-methyloxolane-2-carboxamide is CC1(C)CC(C(CCNC(=O)C2(C)CCCO2)c2ccc(F)cc2)CCO1.
What is the InChIKey of N-[3-(2,2-dimethyloxan-4-yl)-3-(4-fluorophenyl)propyl]-2-methyloxolane-2-carboxamide?
The InChIKey is IDOIPAWMUBQQKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H32FNO3/c1-21(2)15-17(10-14-26-21)19(16-5-7-18(23)8-6-16)9-12-24-20(25)22(3)11-4-13-27-22/h5-8,17,19H,4,9-15H2,1-3H3,(H,24,25).
What are the key properties of N-[3-(2,2-dimethyloxan-4-yl)-3-(4-fluorophenyl)propyl]-2-methyloxolane-2-carboxamide?
N-[3-(2,2-dimethyloxan-4-yl)-3-(4-fluorophenyl)propyl]-2-methyloxolane-2-carboxamide has a molecular weight of 377.50 g/mol, XLogP of 4.19, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-(2,2-dimethyloxan-4-yl)-3-(4-fluorophenyl)propyl]-2-methyloxolane-2-carboxamide is sourced from PubChem (CID 46954592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).