C19H18N2OS2 — CID 46955476
N-[(3-prop-2-ynoxyphenyl)methyl]-1-(1,3-thiazol-2-yl)-2-thiophen-3-ylethanamine (PubChem CID 46955476) has the molecular formula C19H18N2OS2 and a molecular weight of 354.50 g/mol. Its IUPAC name is N-[(3-prop-2-ynoxyphenyl)methyl]-1-(1,3-thiazol-2-yl)-2-thiophen-3-ylethanamine.
| Compound Name | N-[(3-prop-2-ynoxyphenyl)methyl]-1-(1,3-thiazol-2-yl)-2-thiophen-3-ylethanamine |
|---|---|
| PubChem CID | 46955476 |
| Molecular Formula | C19H18N2OS2 |
| Molecular Weight | 354.50 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | N-[(3-prop-2-ynoxyphenyl)methyl]-1-(1,3-thiazol-2-yl)-2-thiophen-3-ylethanamine |
| SMILES | C#CCOc1cccc(CNC(Cc2ccsc2)c2nccs2)c1 |
| InChI | InChI=1S/C19H18N2OS2/c1-2-8-22-17-5-3-4-15(11-17)13-21-18(19-20-7-10-24-19)12-16-6-9-23-14-16/h1,3-7,9-11,14,18,21H,8,12-13H2 |
| InChIKey | UOHWVOWOPYKHRB-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.50 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|