C27H34N2O3S — CID 4695603
[4-(4-methoxybenzoyl)-1-thia-4,8-diazaspiro[4.5]decan-8-yl]-(4-pentylphenyl)methanone (PubChem CID 4695603) has the molecular formula C27H34N2O3S and a molecular weight of 466.65 g/mol. Its IUPAC name is [4-(4-methoxybenzoyl)-1-thia-4,8-diazaspiro[4.5]decan-8-yl]-(4-pentylphenyl)methanone.
| Compound Name | [4-(4-methoxybenzoyl)-1-thia-4,8-diazaspiro[4.5]decan-8-yl]-(4-pentylphenyl)methanone |
|---|---|
| PubChem CID | 4695603 |
| Molecular Formula | C27H34N2O3S |
| Molecular Weight | 466.65 g/mol |
| Exact Mass | 466.23 |
| IUPAC Name | [4-(4-methoxybenzoyl)-1-thia-4,8-diazaspiro[4.5]decan-8-yl]-(4-pentylphenyl)methanone |
| SMILES | CCCCCc1ccc(C(=O)N2CCC3(CC2)SCCN3C(=O)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C27H34N2O3S/c1-3-4-5-6-21-7-9-22(10-8-21)25(30)28-17-15-27(16-18-28)29(19-20-33-27)26(31)23-11-13-24(32-2)14-12-23/h7-14H,3-6,15-20H2,1-2H3 |
| InChIKey | GXXIHORSEHIJKJ-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.65 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|