C27H33BrN2O2S — CID 3878934
[4-(4-bromobenzoyl)-1-thia-4,8-diazaspiro[4.5]decan-8-yl]-(4-hexylphenyl)methanone (PubChem CID 3878934) has the molecular formula C27H33BrN2O2S and a molecular weight of 529.54 g/mol. Its IUPAC name is [4-(4-bromobenzoyl)-1-thia-4,8-diazaspiro[4.5]decan-8-yl]-(4-hexylphenyl)methanone.
| Compound Name | [4-(4-bromobenzoyl)-1-thia-4,8-diazaspiro[4.5]decan-8-yl]-(4-hexylphenyl)methanone |
|---|---|
| PubChem CID | 3878934 |
| Molecular Formula | C27H33BrN2O2S |
| Molecular Weight | 529.54 g/mol |
| Exact Mass | 528.14 |
| IUPAC Name | [4-(4-bromobenzoyl)-1-thia-4,8-diazaspiro[4.5]decan-8-yl]-(4-hexylphenyl)methanone |
| SMILES | CCCCCCc1ccc(C(=O)N2CCC3(CC2)SCCN3C(=O)c2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C27H33BrN2O2S/c1-2-3-4-5-6-21-7-9-22(10-8-21)25(31)29-17-15-27(16-18-29)30(19-20-33-27)26(32)23-11-13-24(28)14-12-23/h7-14H,2-6,15-20H2,1H3 |
| InChIKey | GRLDNEPMTNZEQW-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.54 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|