C19H26FN3O2S — CID 4527449
N-butyl-4-(4-fluorobenzoyl)-1-thia-4,8-diazaspiro[4.5]decane-8-carboxamide (PubChem CID 4527449) has the molecular formula C19H26FN3O2S and a molecular weight of 379.50 g/mol. Its IUPAC name is N-butyl-4-(4-fluorobenzoyl)-1-thia-4,8-diazaspiro[4.5]decane-8-carboxamide.
| Compound Name | N-butyl-4-(4-fluorobenzoyl)-1-thia-4,8-diazaspiro[4.5]decane-8-carboxamide |
|---|---|
| PubChem CID | 4527449 |
| Molecular Formula | C19H26FN3O2S |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.17 |
| IUPAC Name | N-butyl-4-(4-fluorobenzoyl)-1-thia-4,8-diazaspiro[4.5]decane-8-carboxamide |
| SMILES | CCCCNC(=O)N1CCC2(CC1)SCCN2C(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C19H26FN3O2S/c1-2-3-10-21-18(25)22-11-8-19(9-12-22)23(13-14-26-19)17(24)15-4-6-16(20)7-5-15/h4-7H,2-3,8-14H2,1H3,(H,21,25) |
| InChIKey | AHUNNIWQUFDWAA-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|