C14H18FN2OS+ — CID 7235012
(4-fluorophenyl)-(1-thia-4-aza-8-azoniaspiro[4.5]decan-4-yl)methanone (PubChem CID 7235012) has the molecular formula C14H18FN2OS+ and a molecular weight of 281.38 g/mol. Its IUPAC name is (4-fluorophenyl)-(1-thia-4-aza-8-azoniaspiro[4.5]decan-4-yl)methanone.
| Compound Name | (4-fluorophenyl)-(1-thia-4-aza-8-azoniaspiro[4.5]decan-4-yl)methanone |
|---|---|
| PubChem CID | 7235012 |
| Molecular Formula | C14H18FN2OS+ |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | (4-fluorophenyl)-(1-thia-4-aza-8-azoniaspiro[4.5]decan-4-yl)methanone |
| SMILES | O=C(c1ccc(F)cc1)N1CCSC12CC[NH2+]CC2 |
| InChI | InChI=1S/C14H17FN2OS/c15-12-3-1-11(2-4-12)13(18)17-9-10-19-14(17)5-7-16-8-6-14/h1-4,16H,5-10H2/p+1 |
| InChIKey | WSGGCIANQJVNAO-UHFFFAOYSA-O |
| XLogP | 1.07 |
| TPSA | 36.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |