C15H21N2OS+ — CID 7231250
(2-methylphenyl)-(1-thia-4-aza-8-azoniaspiro[4.5]decan-4-yl)methanone (PubChem CID 7231250) has the molecular formula C15H21N2OS+ and a molecular weight of 277.41 g/mol. Its IUPAC name is (2-methylphenyl)-(1-thia-4-aza-8-azoniaspiro[4.5]decan-4-yl)methanone.
| Compound Name | (2-methylphenyl)-(1-thia-4-aza-8-azoniaspiro[4.5]decan-4-yl)methanone |
|---|---|
| PubChem CID | 7231250 |
| Molecular Formula | C15H21N2OS+ |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.14 |
| IUPAC Name | (2-methylphenyl)-(1-thia-4-aza-8-azoniaspiro[4.5]decan-4-yl)methanone |
| SMILES | Cc1ccccc1C(=O)N1CCSC12CC[NH2+]CC2 |
| InChI | InChI=1S/C15H20N2OS/c1-12-4-2-3-5-13(12)14(18)17-10-11-19-15(17)6-8-16-9-7-15/h2-5,16H,6-11H2,1H3/p+1 |
| InChIKey | GLJQMGAOUOCOAQ-UHFFFAOYSA-O |
| XLogP | 1.24 |
| TPSA | 36.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |