C16H21N5OS — CID 46958991
7,11,12-trimethyl-4-(2-pyrrolidin-1-ylethyl)-10-thia-3,4,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,7,11-tetraen-5-one (PubChem CID 46958991) has the molecular formula C16H21N5OS and a molecular weight of 331.45 g/mol. Its IUPAC name is 7,11,12-trimethyl-4-(2-pyrrolidin-1-ylethyl)-10-thia-3,4,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,7,11-tetraen-5-one.
| Compound Name | 7,11,12-trimethyl-4-(2-pyrrolidin-1-ylethyl)-10-thia-3,4,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,7,11-tetraen-5-one |
|---|---|
| PubChem CID | 46958991 |
| Molecular Formula | C16H21N5OS |
| Molecular Weight | 331.45 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | 7,11,12-trimethyl-4-(2-pyrrolidin-1-ylethyl)-10-thia-3,4,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,7,11-tetraen-5-one |
| SMILES | Cc1sc2nc(C)n3c(=O)n(CCN4CCCC4)nc3c2c1C |
| InChI | InChI=1S/C16H21N5OS/c1-10-11(2)23-15-13(10)14-18-20(9-8-19-6-4-5-7-19)16(22)21(14)12(3)17-15/h4-9H2,1-3H3 |
| InChIKey | XJKPNGNGHSLVJV-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 55.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.45 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |